C38H32N12 — CID 139060875
5-methyl-2-phenyl-6-phenyldiazenylpyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 139060875) has the molecular formula C38H32N12 and a molecular weight of 656.76 g/mol. Its IUPAC name is 5-methyl-2-phenyl-6-phenyldiazenylpyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-methyl-2-phenyl-6-phenyldiazenylpyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 139060875 |
| Molecular Formula | C38H32N12 |
| Molecular Weight | 656.76 g/mol |
| Exact Mass | 656.29 |
| IUPAC Name | 5-methyl-2-phenyl-6-phenyldiazenylpyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1nc2cc(-c3ccccc3)nn2c(N)c1/N=N/c1ccccc1.Cc1nc2cc(-c3ccccc3)nn2c(N)c1/N=N/c1ccccc1 |
| InChI | InChI=1S/2C19H16N6/c2*1-13-18(23-22-15-10-6-3-7-11-15)19(20)25-17(21-13)12-16(24-25)14-8-4-2-5-9-14/h2*2-12H,20H2,1H3/b2*23-22+ |
| InChIKey | VKRPZWFFDAIJTN-LMPRYKABSA-N |
| XLogP | 9.40 |
| TPSA | 161.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.76 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|