C22H17N5 — CID 10689276
4,6-diphenyl-5-phenyldiazenylpyrimidin-2-amine (PubChem CID 10689276) has the molecular formula C22H17N5 and a molecular weight of 351.41 g/mol. Its IUPAC name is 4,6-diphenyl-5-phenyldiazenylpyrimidin-2-amine.
| Compound Name | 4,6-diphenyl-5-phenyldiazenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 10689276 |
| Molecular Formula | C22H17N5 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 4,6-diphenyl-5-phenyldiazenylpyrimidin-2-amine |
| SMILES | Nc1nc(-c2ccccc2)c(/N=N/c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H17N5/c23-22-24-19(16-10-4-1-5-11-16)21(27-26-18-14-8-3-9-15-18)20(25-22)17-12-6-2-7-13-17/h1-15H,(H2,23,24,25)/b27-26+ |
| InChIKey | CXCJZZXIKFKLPG-CYYJNZCTSA-N |
| XLogP | 5.81 |
| TPSA | 76.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|