C12H11N7 — CID 119087986
4-phenylpteridine-2,6,7-triamine (PubChem CID 119087986) has the molecular formula C12H11N7 and a molecular weight of 253.27 g/mol. Its IUPAC name is 4-phenylpteridine-2,6,7-triamine.
| Compound Name | 4-phenylpteridine-2,6,7-triamine |
|---|---|
| PubChem CID | 119087986 |
| Molecular Formula | C12H11N7 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-phenylpteridine-2,6,7-triamine |
| SMILES | Nc1nc(-c2ccccc2)c2nc(N)c(N)nc2n1 |
| InChI | InChI=1S/C12H11N7/c13-9-10(14)18-11-8(16-9)7(17-12(15)19-11)6-4-2-1-3-5-6/h1-5H,(H2,13,16)(H4,14,15,17,18,19) |
| InChIKey | OYUHSNWDUSVMDD-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |