C12H10BrN7 — CID 118987043
6-(3-bromophenyl)pteridine-2,4,7-triamine (PubChem CID 118987043) has the molecular formula C12H10BrN7 and a molecular weight of 332.17 g/mol. Its IUPAC name is 6-(3-bromophenyl)pteridine-2,4,7-triamine.
| Compound Name | 6-(3-bromophenyl)pteridine-2,4,7-triamine |
|---|---|
| PubChem CID | 118987043 |
| Molecular Formula | C12H10BrN7 |
| Molecular Weight | 332.17 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 6-(3-bromophenyl)pteridine-2,4,7-triamine |
| SMILES | Nc1nc(N)c2nc(-c3cccc(Br)c3)c(N)nc2n1 |
| InChI | InChI=1S/C12H10BrN7/c13-6-3-1-2-5(4-6)7-9(14)18-11-8(17-7)10(15)19-12(16)20-11/h1-4H,(H6,14,15,16,18,19,20) |
| InChIKey | UWFFWZGQGRBIBG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.17 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |