C12H11KN7O4S — CID 169442251
4-Hydroxy triamterene sulfate potassium salt (PubChem CID 169442251) has the molecular formula C12H11KN7O4S and a molecular weight of 388.43 g/mol.
| Compound Name | 4-Hydroxy triamterene sulfate potassium salt |
|---|---|
| PubChem CID | 169442251 |
| Molecular Formula | C12H11KN7O4S |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | — |
| SMILES | Nc1nc(N)c2nc(-c3ccc(OS(=O)(=O)O)cc3)c(N)nc2n1.[K] |
| InChI | InChI=1S/C12H11N7O4S.K/c13-9-7(5-1-3-6(4-2-5)23-24(20,21)22)16-8-10(14)18-12(15)19-11(8)17-9;/h1-4H,(H,20,21,22)(H6,13,14,15,17,18,19); |
| InChIKey | YIWNWIRASCPBJZ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 193.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|