C8H14N4O5S — CID 70926549
(2,4-diamino-6-butoxypyrimidin-5-yl) hydrogen sulfate (PubChem CID 70926549) has the molecular formula C8H14N4O5S and a molecular weight of 278.29 g/mol. Its IUPAC name is (2,4-diamino-6-butoxypyrimidin-5-yl) hydrogen sulfate.
| Compound Name | (2,4-diamino-6-butoxypyrimidin-5-yl) hydrogen sulfate |
|---|---|
| PubChem CID | 70926549 |
| Molecular Formula | C8H14N4O5S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | (2,4-diamino-6-butoxypyrimidin-5-yl) hydrogen sulfate |
| SMILES | CCCCOc1nc(N)nc(N)c1OS(=O)(=O)O |
| InChI | InChI=1S/C8H14N4O5S/c1-2-3-4-16-7-5(17-18(13,14)15)6(9)11-8(10)12-7/h2-4H2,1H3,(H,13,14,15)(H4,9,10,11,12) |
| InChIKey | KLNZUFRTRJNLGF-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 150.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|