C11H14N4O2 — CID 170186267
2-amino-4-butoxy-6H-pyrido[4,3-d]pyrimidin-5-one (PubChem CID 170186267) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 2-amino-4-butoxy-6H-pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 2-amino-4-butoxy-6H-pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 170186267 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 2-amino-4-butoxy-6H-pyrido[4,3-d]pyrimidin-5-one |
| SMILES | CCCCOc1nc(N)nc2cc[nH]c(=O)c12 |
| InChI | InChI=1S/C11H14N4O2/c1-2-3-6-17-10-8-7(14-11(12)15-10)4-5-13-9(8)16/h4-5H,2-3,6H2,1H3,(H,13,16)(H2,12,14,15) |
| InChIKey | ZNVIJLDYDCEWQU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|