C13H19N5O — CID 170186453
2-amino-4-[[(3R)-hexan-3-yl]amino]-6H-pyrido[4,3-d]pyrimidin-5-one (PubChem CID 170186453) has the molecular formula C13H19N5O and a molecular weight of 261.33 g/mol. Its IUPAC name is 2-amino-4-[[(3R)-hexan-3-yl]amino]-6H-pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 2-amino-4-[[(3R)-hexan-3-yl]amino]-6H-pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 170186453 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 2-amino-4-[[(3R)-hexan-3-yl]amino]-6H-pyrido[4,3-d]pyrimidin-5-one |
| SMILES | CCC[C@@H](CC)Nc1nc(N)nc2cc[nH]c(=O)c12 |
| InChI | InChI=1S/C13H19N5O/c1-3-5-8(4-2)16-11-10-9(17-13(14)18-11)6-7-15-12(10)19/h6-8H,3-5H2,1-2H3,(H,15,19)(H3,14,16,17,18)/t8-/m1/s1 |
| InChIKey | GVRHAGHLZLEGGJ-MRVPVSSYSA-N |
| XLogP | 1.89 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |