C12H19N5O — CID 129103735
(2S)-2-[(2-amino-5H-pyrrolo[3,2-d]pyrimidin-4-yl)amino]hexan-1-ol (PubChem CID 129103735) has the molecular formula C12H19N5O and a molecular weight of 249.32 g/mol. Its IUPAC name is (2S)-2-[(2-amino-5H-pyrrolo[3,2-d]pyrimidin-4-yl)amino]hexan-1-ol.
| Compound Name | (2S)-2-[(2-amino-5H-pyrrolo[3,2-d]pyrimidin-4-yl)amino]hexan-1-ol |
|---|---|
| PubChem CID | 129103735 |
| Molecular Formula | C12H19N5O |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | (2S)-2-[(2-amino-5H-pyrrolo[3,2-d]pyrimidin-4-yl)amino]hexan-1-ol |
| SMILES | CCCC[C@@H](CO)Nc1nc(N)nc2cc[nH]c12 |
| InChI | InChI=1S/C12H19N5O/c1-2-3-4-8(7-18)15-11-10-9(5-6-14-10)16-12(13)17-11/h5-6,8,14,18H,2-4,7H2,1H3,(H3,13,15,16,17)/t8-/m0/s1 |
| InChIKey | FRUUVGCZLTYJPG-QMMMGPOBSA-N |
| XLogP | 1.50 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |