C15H20N4O3 — CID 71041916
methyl 2-amino-4-[[(2S)-1-hydroxypentan-2-yl]amino]quinazoline-7-carboxylate (PubChem CID 71041916) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is methyl 2-amino-4-[[(2S)-1-hydroxypentan-2-yl]amino]quinazoline-7-carboxylate.
| Compound Name | methyl 2-amino-4-[[(2S)-1-hydroxypentan-2-yl]amino]quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 71041916 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | methyl 2-amino-4-[[(2S)-1-hydroxypentan-2-yl]amino]quinazoline-7-carboxylate |
| SMILES | CCC[C@@H](CO)Nc1nc(N)nc2cc(C(=O)OC)ccc12 |
| InChI | InChI=1S/C15H20N4O3/c1-3-4-10(8-20)17-13-11-6-5-9(14(21)22-2)7-12(11)18-15(16)19-13/h5-7,10,20H,3-4,8H2,1-2H3,(H3,16,17,18,19)/t10-/m0/s1 |
| InChIKey | PAPYBPHMSZNPHK-JTQLQIEISA-N |
| XLogP | 1.57 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |