C12H15ClFN5O — CID 122598706
(2S)-2-[(2-amino-6-chloro-7-fluoropyrido[3,2-d]pyrimidin-4-yl)amino]pentan-1-ol (PubChem CID 122598706) has the molecular formula C12H15ClFN5O and a molecular weight of 299.74 g/mol. Its IUPAC name is (2S)-2-[(2-amino-6-chloro-7-fluoropyrido[3,2-d]pyrimidin-4-yl)amino]pentan-1-ol.
| Compound Name | (2S)-2-[(2-amino-6-chloro-7-fluoropyrido[3,2-d]pyrimidin-4-yl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 122598706 |
| Molecular Formula | C12H15ClFN5O |
| Molecular Weight | 299.74 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (2S)-2-[(2-amino-6-chloro-7-fluoropyrido[3,2-d]pyrimidin-4-yl)amino]pentan-1-ol |
| SMILES | CCC[C@@H](CO)Nc1nc(N)nc2cc(F)c(Cl)nc12 |
| InChI | InChI=1S/C12H15ClFN5O/c1-2-3-6(5-20)16-11-9-8(17-12(15)19-11)4-7(14)10(13)18-9/h4,6,20H,2-3,5H2,1H3,(H3,15,16,17,19)/t6-/m0/s1 |
| InChIKey | GWQOVEBRNJVRRB-LURJTMIESA-N |
| XLogP | 1.97 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.74 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|