C12H14Cl2N4O — CID 122585216
(2S)-2-[(2,7-dichloropyrido[3,2-d]pyrimidin-4-yl)amino]pentan-1-ol (PubChem CID 122585216) has the molecular formula C12H14Cl2N4O and a molecular weight of 301.18 g/mol. Its IUPAC name is (2S)-2-[(2,7-dichloropyrido[3,2-d]pyrimidin-4-yl)amino]pentan-1-ol.
| Compound Name | (2S)-2-[(2,7-dichloropyrido[3,2-d]pyrimidin-4-yl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 122585216 |
| Molecular Formula | C12H14Cl2N4O |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | (2S)-2-[(2,7-dichloropyrido[3,2-d]pyrimidin-4-yl)amino]pentan-1-ol |
| SMILES | CCC[C@@H](CO)Nc1nc(Cl)nc2cc(Cl)cnc12 |
| InChI | InChI=1S/C12H14Cl2N4O/c1-2-3-8(6-19)16-11-10-9(17-12(14)18-11)4-7(13)5-15-10/h4-5,8,19H,2-3,6H2,1H3,(H,16,17,18)/t8-/m0/s1 |
| InChIKey | OXNOSKDBNDJDIN-QMMMGPOBSA-N |
| XLogP | 2.90 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |