C15H24N4O2S — CID 158174222
(2S)-2-[(2-amino-7-methoxyquinazolin-4-yl)amino]hexan-1-ol;sulfane (PubChem CID 158174222) has the molecular formula C15H24N4O2S and a molecular weight of 324.45 g/mol. Its IUPAC name is (2S)-2-[(2-amino-7-methoxyquinazolin-4-yl)amino]hexan-1-ol;sulfane.
| Compound Name | (2S)-2-[(2-amino-7-methoxyquinazolin-4-yl)amino]hexan-1-ol;sulfane |
|---|---|
| PubChem CID | 158174222 |
| Molecular Formula | C15H24N4O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (2S)-2-[(2-amino-7-methoxyquinazolin-4-yl)amino]hexan-1-ol;sulfane |
| SMILES | CCCC[C@@H](CO)Nc1nc(N)nc2cc(OC)ccc12.S |
| InChI | InChI=1S/C15H22N4O2.H2S/c1-3-4-5-10(9-20)17-14-12-7-6-11(21-2)8-13(12)18-15(16)19-14;/h6-8,10,20H,3-5,9H2,1-2H3,(H3,16,17,18,19);1H2/t10-;/m0./s1 |
| InChIKey | FXUSNCBWXMAFNC-PPHPATTJSA-N |
| XLogP | 2.30 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |