C29H44N8O3 — CID 161054075
[2-amino-4-(butylamino)quinazolin-7-yl]methanol;methane;methyl 2-amino-4-(butylamino)quinazoline-7-carboxylate (PubChem CID 161054075) has the molecular formula C29H44N8O3 and a molecular weight of 552.72 g/mol. Its IUPAC name is [2-amino-4-(butylamino)quinazolin-7-yl]methanol;methane;methyl 2-amino-4-(butylamino)quinazoline-7-carboxylate.
| Compound Name | [2-amino-4-(butylamino)quinazolin-7-yl]methanol;methane;methyl 2-amino-4-(butylamino)quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 161054075 |
| Molecular Formula | C29H44N8O3 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.35 |
| IUPAC Name | [2-amino-4-(butylamino)quinazolin-7-yl]methanol;methane;methyl 2-amino-4-(butylamino)quinazoline-7-carboxylate |
| SMILES | C.C.CCCCNc1nc(N)nc2cc(C(=O)OC)ccc12.CCCCNc1nc(N)nc2cc(CO)ccc12 |
| InChI | InChI=1S/C14H18N4O2.C13H18N4O.2CH4/c1-3-4-7-16-12-10-6-5-9(13(19)20-2)8-11(10)17-14(15)18-12;1-2-3-6-15-12-10-5-4-9(8-18)7-11(10)16-13(14)17-12;;/h5-6,8H,3-4,7H2,1-2H3,(H3,15,16,17,18);4-5,7,18H,2-3,6,8H2,1H3,(H3,14,15,16,17);2*1H4 |
| InChIKey | UCMZMCKIDSBZGX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 174.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|