About methane;methyl 3-methylquinoline-6-carboxylate;(3-methylquinolin-6-yl)methanol
methane;methyl 3-methylquinoline-6-carboxylate;(3-methylquinolin-6-yl)methanol (PubChem CID 158164435) has the molecular formula C25H30N2O3
and a molecular weight of 406.53 g/mol. Its IUPAC name is methane;methyl 3-methylquinoline-6-carboxylate;(3-methylquinolin-6-yl)methanol.
Molecular Properties
| Compound Name | methane;methyl 3-methylquinoline-6-carboxylate;(3-methylquinolin-6-yl)methanol |
| PubChem CID | 158164435 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | methane;methyl 3-methylquinoline-6-carboxylate;(3-methylquinolin-6-yl)methanol |
| SMILES | C.C.COC(=O)c1ccc2ncc(C)cc2c1.Cc1cnc2ccc(CO)cc2c1 |
| InChI | InChI=1S/C12H11NO2.C11H11NO.2CH4/c1-8-5-10-6-9(12(14)15-2)3-4-11(10)13-7-8;1-8-4-10-5-9(7-13)2-3-11(10)12-6-8;;/h3-7H,1-2H3;2-6,13H,7H2,1H3;2*1H4 |
| InChIKey | FWRAWDMFJGERDH-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methane;methyl 3-methylquinoline-6-carboxylate;(3-methylquinolin-6-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;methyl 3-methylquinoline-6-carboxylate;(3-methylquinolin-6-yl)methanol?
The IUPAC name of methane;methyl 3-methylquinoline-6-carboxylate;(3-methylquinolin-6-yl)methanol (CID 158164435) is methane;methyl 3-methylquinoline-6-carboxylate;(3-methylquinolin-6-yl)methanol.
What is the SMILES notation for methane;methyl 3-methylquinoline-6-carboxylate;(3-methylquinolin-6-yl)methanol?
The canonical SMILES for methane;methyl 3-methylquinoline-6-carboxylate;(3-methylquinolin-6-yl)methanol is C.C.COC(=O)c1ccc2ncc(C)cc2c1.Cc1cnc2ccc(CO)cc2c1.
What is the InChIKey of methane;methyl 3-methylquinoline-6-carboxylate;(3-methylquinolin-6-yl)methanol?
The InChIKey is FWRAWDMFJGERDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2.C11H11NO.2CH4/c1-8-5-10-6-9(12(14)15-2)3-4-11(10)13-7-8;1-8-4-10-5-9(7-13)2-3-11(10)12-6-8;;/h3-7H,1-2H3;2-6,13H,7H2,1H3;2*1H4.
What are the key properties of methane;methyl 3-methylquinoline-6-carboxylate;(3-methylquinolin-6-yl)methanol?
methane;methyl 3-methylquinoline-6-carboxylate;(3-methylquinolin-6-yl)methanol has a molecular weight of 406.53 g/mol, XLogP of 5.64, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methyl 3-methylquinoline-6-carboxylate;(3-methylquinolin-6-yl)methanol is sourced from PubChem (CID 158164435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).