About ethane;methyl 2-hydroxy-4-imino-2-methyl-4-(3-methylquinolin-6-yl)butanoate
ethane;methyl 2-hydroxy-4-imino-2-methyl-4-(3-methylquinolin-6-yl)butanoate (PubChem CID 144595385) has the molecular formula C18H24N2O3
and a molecular weight of 316.40 g/mol. Its IUPAC name is ethane;methyl 2-hydroxy-4-imino-2-methyl-4-(3-methylquinolin-6-yl)butanoate.
Molecular Properties
| Compound Name | ethane;methyl 2-hydroxy-4-imino-2-methyl-4-(3-methylquinolin-6-yl)butanoate |
| PubChem CID | 144595385 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | ethane;methyl 2-hydroxy-4-imino-2-methyl-4-(3-methylquinolin-6-yl)butanoate |
| SMILES | CC.[H]/N=C(/CC(C)(O)C(=O)OC)c1ccc2ncc(C)cc2c1 |
| InChI | InChI=1S/C16H18N2O3.C2H6/c1-10-6-12-7-11(4-5-14(12)18-9-10)13(17)8-16(2,20)15(19)21-3;1-2/h4-7,9,17,20H,8H2,1-3H3;1-2H3/b17-13-; |
| InChIKey | KROBDCLBBUSETD-VSORCOHTSA-N |
| XLogP | 3.25 |
| TPSA | 83.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl 2-hydroxy-4-imino-2-methyl-4-(3-methylquinolin-6-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 2-hydroxy-4-imino-2-methyl-4-(3-methylquinolin-6-yl)butanoate?
The IUPAC name of ethane;methyl 2-hydroxy-4-imino-2-methyl-4-(3-methylquinolin-6-yl)butanoate (CID 144595385) is ethane;methyl 2-hydroxy-4-imino-2-methyl-4-(3-methylquinolin-6-yl)butanoate.
What is the SMILES notation for ethane;methyl 2-hydroxy-4-imino-2-methyl-4-(3-methylquinolin-6-yl)butanoate?
The canonical SMILES for ethane;methyl 2-hydroxy-4-imino-2-methyl-4-(3-methylquinolin-6-yl)butanoate is CC.[H]/N=C(/CC(C)(O)C(=O)OC)c1ccc2ncc(C)cc2c1.
What is the InChIKey of ethane;methyl 2-hydroxy-4-imino-2-methyl-4-(3-methylquinolin-6-yl)butanoate?
The InChIKey is KROBDCLBBUSETD-VSORCOHTSA-N. The full InChI is InChI=1S/C16H18N2O3.C2H6/c1-10-6-12-7-11(4-5-14(12)18-9-10)13(17)8-16(2,20)15(19)21-3;1-2/h4-7,9,17,20H,8H2,1-3H3;1-2H3/b17-13-;.
What are the key properties of ethane;methyl 2-hydroxy-4-imino-2-methyl-4-(3-methylquinolin-6-yl)butanoate?
ethane;methyl 2-hydroxy-4-imino-2-methyl-4-(3-methylquinolin-6-yl)butanoate has a molecular weight of 316.40 g/mol, XLogP of 3.25, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 2-hydroxy-4-imino-2-methyl-4-(3-methylquinolin-6-yl)butanoate is sourced from PubChem (CID 144595385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).