C18H21NO3 — CID 20849712
[2-imino-2-(6-methoxynaphthalen-2-yl)ethyl] 2,2-dimethylpropanoate (PubChem CID 20849712) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is [2-imino-2-(6-methoxynaphthalen-2-yl)ethyl] 2,2-dimethylpropanoate.
| Compound Name | [2-imino-2-(6-methoxynaphthalen-2-yl)ethyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 20849712 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | [2-imino-2-(6-methoxynaphthalen-2-yl)ethyl] 2,2-dimethylpropanoate |
| SMILES | [H]/N=C(\COC(=O)C(C)(C)C)c1ccc2cc(OC)ccc2c1 |
| InChI | InChI=1S/C18H21NO3/c1-18(2,3)17(20)22-11-16(19)14-6-5-13-10-15(21-4)8-7-12(13)9-14/h5-10,19H,11H2,1-4H3/b19-16+ |
| InChIKey | UAKUYHAMJALYMB-KNTRCKAVSA-N |
| XLogP | 3.81 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|