C20H23N5O2 — CID 147453813
methyl 3-[[2-amino-4-(butylamino)pyrido[3,2-d]pyrimidin-6-yl]methyl]benzoate (PubChem CID 147453813) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is methyl 3-[[2-amino-4-(butylamino)pyrido[3,2-d]pyrimidin-6-yl]methyl]benzoate.
| Compound Name | methyl 3-[[2-amino-4-(butylamino)pyrido[3,2-d]pyrimidin-6-yl]methyl]benzoate |
|---|---|
| PubChem CID | 147453813 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | methyl 3-[[2-amino-4-(butylamino)pyrido[3,2-d]pyrimidin-6-yl]methyl]benzoate |
| SMILES | CCCCNc1nc(N)nc2ccc(Cc3cccc(C(=O)OC)c3)nc12 |
| InChI | InChI=1S/C20H23N5O2/c1-3-4-10-22-18-17-16(24-20(21)25-18)9-8-15(23-17)12-13-6-5-7-14(11-13)19(26)27-2/h5-9,11H,3-4,10,12H2,1-2H3,(H3,21,22,24,25) |
| InChIKey | DYOQVOKAURHUJB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|