C19H24N6 — CID 149046473
6-[[4-(aminomethyl)phenyl]methyl]-4-N-butylpyrido[3,2-d]pyrimidine-2,4-diamine (PubChem CID 149046473) has the molecular formula C19H24N6 and a molecular weight of 336.44 g/mol. Its IUPAC name is 6-[[4-(aminomethyl)phenyl]methyl]-4-N-butylpyrido[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 6-[[4-(aminomethyl)phenyl]methyl]-4-N-butylpyrido[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 149046473 |
| Molecular Formula | C19H24N6 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 6-[[4-(aminomethyl)phenyl]methyl]-4-N-butylpyrido[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CCCCNc1nc(N)nc2ccc(Cc3ccc(CN)cc3)nc12 |
| InChI | InChI=1S/C19H24N6/c1-2-3-10-22-18-17-16(24-19(21)25-18)9-8-15(23-17)11-13-4-6-14(12-20)7-5-13/h4-9H,2-3,10-12,20H2,1H3,(H3,21,22,24,25) |
| InChIKey | QIRSUHYYQPKUQV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|