C18H20N5O2S+ — CID 174109488
[4-[[2-amino-4-(butylamino)-5-oxopyrido[4,3-d]pyrimidin-6-yl]methyl]phenyl]-oxosulfanium (PubChem CID 174109488) has the molecular formula C18H20N5O2S+ and a molecular weight of 370.46 g/mol. Its IUPAC name is [4-[[2-amino-4-(butylamino)-5-oxopyrido[4,3-d]pyrimidin-6-yl]methyl]phenyl]-oxosulfanium.
| Compound Name | [4-[[2-amino-4-(butylamino)-5-oxopyrido[4,3-d]pyrimidin-6-yl]methyl]phenyl]-oxosulfanium |
|---|---|
| PubChem CID | 174109488 |
| Molecular Formula | C18H20N5O2S+ |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | [4-[[2-amino-4-(butylamino)-5-oxopyrido[4,3-d]pyrimidin-6-yl]methyl]phenyl]-oxosulfanium |
| SMILES | CCCCNc1nc(N)nc2ccn(Cc3ccc([S+]=O)cc3)c(=O)c12 |
| InChI | InChI=1S/C18H19N5O2S/c1-2-3-9-20-16-15-14(21-18(19)22-16)8-10-23(17(15)24)11-12-4-6-13(26-25)7-5-12/h4-8,10H,2-3,9,11H2,1H3,(H2-,19,20,21,22,24)/p+1 |
| InChIKey | GJBROMCNJIYPQX-UHFFFAOYSA-O |
| XLogP | 2.42 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|