C20H27N7O2 — CID 169192938
2-amino-4-(butylamino)-6-[[4-[2-(methylamino)ethoxy]phenyl]methyl]pyrimido[4,5-d]pyridazin-5-one (PubChem CID 169192938) has the molecular formula C20H27N7O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 2-amino-4-(butylamino)-6-[[4-[2-(methylamino)ethoxy]phenyl]methyl]pyrimido[4,5-d]pyridazin-5-one.
| Compound Name | 2-amino-4-(butylamino)-6-[[4-[2-(methylamino)ethoxy]phenyl]methyl]pyrimido[4,5-d]pyridazin-5-one |
|---|---|
| PubChem CID | 169192938 |
| Molecular Formula | C20H27N7O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 2-amino-4-(butylamino)-6-[[4-[2-(methylamino)ethoxy]phenyl]methyl]pyrimido[4,5-d]pyridazin-5-one |
| SMILES | CCCCNc1nc(N)nc2cnn(Cc3ccc(OCCNC)cc3)c(=O)c12 |
| InChI | InChI=1S/C20H27N7O2/c1-3-4-9-23-18-17-16(25-20(21)26-18)12-24-27(19(17)28)13-14-5-7-15(8-6-14)29-11-10-22-2/h5-8,12,22H,3-4,9-11,13H2,1-2H3,(H3,21,23,25,26) |
| InChIKey | JVSJCKBQNGGCOV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|