C19H22ClN5O2 — CID 176639630
2-amino-4-(butylamino)-8-chloro-6-[[4-(hydroxymethyl)phenyl]methyl]pyrido[4,3-d]pyrimidin-5-one (PubChem CID 176639630) has the molecular formula C19H22ClN5O2 and a molecular weight of 387.87 g/mol. Its IUPAC name is 2-amino-4-(butylamino)-8-chloro-6-[[4-(hydroxymethyl)phenyl]methyl]pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 2-amino-4-(butylamino)-8-chloro-6-[[4-(hydroxymethyl)phenyl]methyl]pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 176639630 |
| Molecular Formula | C19H22ClN5O2 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 2-amino-4-(butylamino)-8-chloro-6-[[4-(hydroxymethyl)phenyl]methyl]pyrido[4,3-d]pyrimidin-5-one |
| SMILES | CCCCNc1nc(N)nc2c(Cl)cn(Cc3ccc(CO)cc3)c(=O)c12 |
| InChI | InChI=1S/C19H22ClN5O2/c1-2-3-8-22-17-15-16(23-19(21)24-17)14(20)10-25(18(15)27)9-12-4-6-13(11-26)7-5-12/h4-7,10,26H,2-3,8-9,11H2,1H3,(H3,21,22,23,24) |
| InChIKey | RQBUQEUOEPNAPK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|