C18H23N5O2 — CID 171653891
[4-[[2-amino-4-(butoxyamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]phenyl]methanol (PubChem CID 171653891) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is [4-[[2-amino-4-(butoxyamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]phenyl]methanol.
| Compound Name | [4-[[2-amino-4-(butoxyamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 171653891 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | [4-[[2-amino-4-(butoxyamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]phenyl]methanol |
| SMILES | CCCCONc1nc(N)nc2ccn(Cc3ccc(CO)cc3)c12 |
| InChI | InChI=1S/C18H23N5O2/c1-2-3-10-25-22-17-16-15(20-18(19)21-17)8-9-23(16)11-13-4-6-14(12-24)7-5-13/h4-9,24H,2-3,10-12H2,1H3,(H3,19,20,21,22) |
| InChIKey | OTGUQSDAITWBRO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|