C24H34N6O — CID 144954877
5-[[2-methoxy-5-(pyrrolidin-1-ylmethyl)phenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine (PubChem CID 144954877) has the molecular formula C24H34N6O and a molecular weight of 422.58 g/mol. Its IUPAC name is 5-[[2-methoxy-5-(pyrrolidin-1-ylmethyl)phenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 5-[[2-methoxy-5-(pyrrolidin-1-ylmethyl)phenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 144954877 |
| Molecular Formula | C24H34N6O |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | 5-[[2-methoxy-5-(pyrrolidin-1-ylmethyl)phenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CCCCCNc1nc(N)nc2ccn(Cc3cc(CN4CCCC4)ccc3OC)c12 |
| InChI | InChI=1S/C24H34N6O/c1-3-4-5-11-26-23-22-20(27-24(25)28-23)10-14-30(22)17-19-15-18(8-9-21(19)31-2)16-29-12-6-7-13-29/h8-10,14-15H,3-7,11-13,16-17H2,1-2H3,(H3,25,26,27,28) |
| InChIKey | MDFYNIHUUONMFW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|