C28H41N7O — CID 155400424
5-[[2-methoxy-4-[(3-piperidin-4-ylazetidin-1-yl)methyl]phenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine (PubChem CID 155400424) has the molecular formula C28H41N7O and a molecular weight of 491.68 g/mol. Its IUPAC name is 5-[[2-methoxy-4-[(3-piperidin-4-ylazetidin-1-yl)methyl]phenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 5-[[2-methoxy-4-[(3-piperidin-4-ylazetidin-1-yl)methyl]phenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 155400424 |
| Molecular Formula | C28H41N7O |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.34 |
| IUPAC Name | 5-[[2-methoxy-4-[(3-piperidin-4-ylazetidin-1-yl)methyl]phenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CCCCCNc1nc(N)nc2ccn(Cc3ccc(CN4CC(C5CCNCC5)C4)cc3OC)c12 |
| InChI | InChI=1S/C28H41N7O/c1-3-4-5-11-31-27-26-24(32-28(29)33-27)10-14-35(26)19-22-7-6-20(15-25(22)36-2)16-34-17-23(18-34)21-8-12-30-13-9-21/h6-7,10,14-15,21,23,30H,3-5,8-9,11-13,16-19H2,1-2H3,(H3,29,31,32,33) |
| InChIKey | RVPVDMDNUNQUCF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|