C24H34N6OS — CID 171548676
5-[[2-methoxy-4-(piperazin-1-ylmethyl)phenyl]methyl]-4-pentylsulfanylpyrrolo[3,2-d]pyrimidin-2-amine (PubChem CID 171548676) has the molecular formula C24H34N6OS and a molecular weight of 454.64 g/mol. Its IUPAC name is 5-[[2-methoxy-4-(piperazin-1-ylmethyl)phenyl]methyl]-4-pentylsulfanylpyrrolo[3,2-d]pyrimidin-2-amine.
| Compound Name | 5-[[2-methoxy-4-(piperazin-1-ylmethyl)phenyl]methyl]-4-pentylsulfanylpyrrolo[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 171548676 |
| Molecular Formula | C24H34N6OS |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 5-[[2-methoxy-4-(piperazin-1-ylmethyl)phenyl]methyl]-4-pentylsulfanylpyrrolo[3,2-d]pyrimidin-2-amine |
| SMILES | CCCCCSc1nc(N)nc2ccn(Cc3ccc(CN4CCNCC4)cc3OC)c12 |
| InChI | InChI=1S/C24H34N6OS/c1-3-4-5-14-32-23-22-20(27-24(25)28-23)8-11-30(22)17-19-7-6-18(15-21(19)31-2)16-29-12-9-26-10-13-29/h6-8,11,15,26H,3-5,9-10,12-14,16-17H2,1-2H3,(H2,25,27,28) |
| InChIKey | IJYVTGNKXILOGF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|