C30H39N7O3S — CID 171548688
1-[2-[4-[[4-[(2-amino-4-pentylsulfanylpyrrolo[3,2-d]pyrimidin-5-yl)methyl]-3-methoxyphenyl]methyl]piperazin-1-yl]ethyl]pyrrole-2,5-dione (PubChem CID 171548688) has the molecular formula C30H39N7O3S and a molecular weight of 577.76 g/mol. Its IUPAC name is 1-[2-[4-[[4-[(2-amino-4-pentylsulfanylpyrrolo[3,2-d]pyrimidin-5-yl)methyl]-3-methoxyphenyl]methyl]piperazin-1-yl]ethyl]pyrrole-2,5-dione.
| Compound Name | 1-[2-[4-[[4-[(2-amino-4-pentylsulfanylpyrrolo[3,2-d]pyrimidin-5-yl)methyl]-3-methoxyphenyl]methyl]piperazin-1-yl]ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 171548688 |
| Molecular Formula | C30H39N7O3S |
| Molecular Weight | 577.76 g/mol |
| Exact Mass | 577.28 |
| IUPAC Name | 1-[2-[4-[[4-[(2-amino-4-pentylsulfanylpyrrolo[3,2-d]pyrimidin-5-yl)methyl]-3-methoxyphenyl]methyl]piperazin-1-yl]ethyl]pyrrole-2,5-dione |
| SMILES | CCCCCSc1nc(N)nc2ccn(Cc3ccc(CN4CCN(CCN5C(=O)C=CC5=O)CC4)cc3OC)c12 |
| InChI | InChI=1S/C30H39N7O3S/c1-3-4-5-18-41-29-28-24(32-30(31)33-29)10-11-36(28)21-23-7-6-22(19-25(23)40-2)20-35-14-12-34(13-15-35)16-17-37-26(38)8-9-27(37)39/h6-11,19H,3-5,12-18,20-21H2,1-2H3,(H2,31,32,33) |
| InChIKey | SHDMSYPVLRZFHH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.76 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|