C25H36N6O — CID 159669949
5-[[2-methoxy-4-(piperidin-1-ylmethyl)phenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine (PubChem CID 159669949) has the molecular formula C25H36N6O and a molecular weight of 436.60 g/mol. Its IUPAC name is 5-[[2-methoxy-4-(piperidin-1-ylmethyl)phenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 5-[[2-methoxy-4-(piperidin-1-ylmethyl)phenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 159669949 |
| Molecular Formula | C25H36N6O |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | 5-[[2-methoxy-4-(piperidin-1-ylmethyl)phenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CCCCCNc1nc(N)nc2ccn(Cc3ccc(CN4CCCCC4)cc3OC)c12 |
| InChI | InChI=1S/C25H36N6O/c1-3-4-6-12-27-24-23-21(28-25(26)29-24)11-15-31(23)18-20-10-9-19(16-22(20)32-2)17-30-13-7-5-8-14-30/h9-11,15-16H,3-8,12-14,17-18H2,1-2H3,(H3,26,27,28,29) |
| InChIKey | QAGWBUXJOMYKAR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|