C23H33N7O — CID 146328513
7-N-butyl-1-[[2-methoxy-4-(piperidin-1-ylmethyl)phenyl]methyl]pyrazolo[4,5-d]pyrimidine-5,7-diamine (PubChem CID 146328513) has the molecular formula C23H33N7O and a molecular weight of 423.57 g/mol. Its IUPAC name is 7-N-butyl-1-[[2-methoxy-4-(piperidin-1-ylmethyl)phenyl]methyl]pyrazolo[4,5-d]pyrimidine-5,7-diamine.
| Compound Name | 7-N-butyl-1-[[2-methoxy-4-(piperidin-1-ylmethyl)phenyl]methyl]pyrazolo[4,5-d]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 146328513 |
| Molecular Formula | C23H33N7O |
| Molecular Weight | 423.57 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | 7-N-butyl-1-[[2-methoxy-4-(piperidin-1-ylmethyl)phenyl]methyl]pyrazolo[4,5-d]pyrimidine-5,7-diamine |
| SMILES | CCCCNc1nc(N)nc2cnn(Cc3ccc(CN4CCCCC4)cc3OC)c12 |
| InChI | InChI=1S/C23H33N7O/c1-3-4-10-25-22-21-19(27-23(24)28-22)14-26-30(21)16-18-9-8-17(13-20(18)31-2)15-29-11-6-5-7-12-29/h8-9,13-14H,3-7,10-12,15-16H2,1-2H3,(H3,24,25,27,28) |
| InChIKey | GNKYIQNXYVQKOW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|