C20H29N7O — CID 166695296
1-[[5-(2-aminopropan-2-yl)-2-methoxyphenyl]methyl]-7-N-butylpyrazolo[4,5-d]pyrimidine-5,7-diamine (PubChem CID 166695296) has the molecular formula C20H29N7O and a molecular weight of 383.50 g/mol. Its IUPAC name is 1-[[5-(2-aminopropan-2-yl)-2-methoxyphenyl]methyl]-7-N-butylpyrazolo[4,5-d]pyrimidine-5,7-diamine.
| Compound Name | 1-[[5-(2-aminopropan-2-yl)-2-methoxyphenyl]methyl]-7-N-butylpyrazolo[4,5-d]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 166695296 |
| Molecular Formula | C20H29N7O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | 1-[[5-(2-aminopropan-2-yl)-2-methoxyphenyl]methyl]-7-N-butylpyrazolo[4,5-d]pyrimidine-5,7-diamine |
| SMILES | CCCCNc1nc(N)nc2cnn(Cc3cc(C(C)(C)N)ccc3OC)c12 |
| InChI | InChI=1S/C20H29N7O/c1-5-6-9-23-18-17-15(25-19(21)26-18)11-24-27(17)12-13-10-14(20(2,3)22)7-8-16(13)28-4/h7-8,10-11H,5-6,9,12,22H2,1-4H3,(H3,21,23,25,26) |
| InChIKey | KDROHCDLITXVBJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 116.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|