C18H22ClN5O2 — CID 163677023
N-butyl-5-chloro-1-[(2,6-dimethoxyphenyl)methyl]pyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 163677023) has the molecular formula C18H22ClN5O2 and a molecular weight of 375.86 g/mol. Its IUPAC name is N-butyl-5-chloro-1-[(2,6-dimethoxyphenyl)methyl]pyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | N-butyl-5-chloro-1-[(2,6-dimethoxyphenyl)methyl]pyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 163677023 |
| Molecular Formula | C18H22ClN5O2 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-butyl-5-chloro-1-[(2,6-dimethoxyphenyl)methyl]pyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCCCNc1nc(Cl)nc2cnn(Cc3c(OC)cccc3OC)c12 |
| InChI | InChI=1S/C18H22ClN5O2/c1-4-5-9-20-17-16-13(22-18(19)23-17)10-21-24(16)11-12-14(25-2)7-6-8-15(12)26-3/h6-8,10H,4-5,9,11H2,1-3H3,(H,20,22,23) |
| InChIKey | JHNZFWMHZALFBQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|