C18H20F2N6O3 — CID 156813200
4-[[5-amino-7-(butylamino)pyrazolo[4,5-d]pyrimidin-1-yl]methyl]-3-(difluoromethoxy)benzoic acid (PubChem CID 156813200) has the molecular formula C18H20F2N6O3 and a molecular weight of 406.39 g/mol. Its IUPAC name is 4-[[5-amino-7-(butylamino)pyrazolo[4,5-d]pyrimidin-1-yl]methyl]-3-(difluoromethoxy)benzoic acid.
| Compound Name | 4-[[5-amino-7-(butylamino)pyrazolo[4,5-d]pyrimidin-1-yl]methyl]-3-(difluoromethoxy)benzoic acid |
|---|---|
| PubChem CID | 156813200 |
| Molecular Formula | C18H20F2N6O3 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 4-[[5-amino-7-(butylamino)pyrazolo[4,5-d]pyrimidin-1-yl]methyl]-3-(difluoromethoxy)benzoic acid |
| SMILES | CCCCNc1nc(N)nc2cnn(Cc3ccc(C(=O)O)cc3OC(F)F)c12 |
| InChI | InChI=1S/C18H20F2N6O3/c1-2-3-6-22-15-14-12(24-18(21)25-15)8-23-26(14)9-11-5-4-10(16(27)28)7-13(11)29-17(19)20/h4-5,7-8,17H,2-3,6,9H2,1H3,(H,27,28)(H3,21,22,24,25) |
| InChIKey | SVOQDKAUQHAVGW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|