C20H26N6O4 — CID 165370610
methyl N-[7-(butylamino)-1-[[5-(hydroxymethyl)-2-methoxyphenyl]methyl]pyrazolo[4,5-d]pyrimidin-5-yl]carbamate (PubChem CID 165370610) has the molecular formula C20H26N6O4 and a molecular weight of 414.47 g/mol. Its IUPAC name is methyl N-[7-(butylamino)-1-[[5-(hydroxymethyl)-2-methoxyphenyl]methyl]pyrazolo[4,5-d]pyrimidin-5-yl]carbamate.
| Compound Name | methyl N-[7-(butylamino)-1-[[5-(hydroxymethyl)-2-methoxyphenyl]methyl]pyrazolo[4,5-d]pyrimidin-5-yl]carbamate |
|---|---|
| PubChem CID | 165370610 |
| Molecular Formula | C20H26N6O4 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | methyl N-[7-(butylamino)-1-[[5-(hydroxymethyl)-2-methoxyphenyl]methyl]pyrazolo[4,5-d]pyrimidin-5-yl]carbamate |
| SMILES | CCCCNc1nc(NC(=O)OC)nc2cnn(Cc3cc(CO)ccc3OC)c12 |
| InChI | InChI=1S/C20H26N6O4/c1-4-5-8-21-18-17-15(23-19(24-18)25-20(28)30-3)10-22-26(17)11-14-9-13(12-27)6-7-16(14)29-2/h6-7,9-10,27H,4-5,8,11-12H2,1-3H3,(H2,21,23,24,25,28) |
| InChIKey | JTBBDAQEOZMCLY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|