C21H24ClF3N6O3 — CID 165370775
methyl N-[7-(butylamino)-1-[[4-(chloromethyl)-2-methoxyphenyl]methyl]-3-(trifluoromethyl)pyrazolo[4,5-d]pyrimidin-5-yl]carbamate (PubChem CID 165370775) has the molecular formula C21H24ClF3N6O3 and a molecular weight of 500.91 g/mol. Its IUPAC name is methyl N-[7-(butylamino)-1-[[4-(chloromethyl)-2-methoxyphenyl]methyl]-3-(trifluoromethyl)pyrazolo[4,5-d]pyrimidin-5-yl]carbamate.
| Compound Name | methyl N-[7-(butylamino)-1-[[4-(chloromethyl)-2-methoxyphenyl]methyl]-3-(trifluoromethyl)pyrazolo[4,5-d]pyrimidin-5-yl]carbamate |
|---|---|
| PubChem CID | 165370775 |
| Molecular Formula | C21H24ClF3N6O3 |
| Molecular Weight | 500.91 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | methyl N-[7-(butylamino)-1-[[4-(chloromethyl)-2-methoxyphenyl]methyl]-3-(trifluoromethyl)pyrazolo[4,5-d]pyrimidin-5-yl]carbamate |
| SMILES | CCCCNc1nc(NC(=O)OC)nc2c(C(F)(F)F)nn(Cc3ccc(CCl)cc3OC)c12 |
| InChI | InChI=1S/C21H24ClF3N6O3/c1-4-5-8-26-18-16-15(27-19(28-18)29-20(32)34-3)17(21(23,24)25)30-31(16)11-13-7-6-12(10-22)9-14(13)33-2/h6-7,9H,4-5,8,10-11H2,1-3H3,(H2,26,27,28,29,32) |
| InChIKey | SSLXMXZECVDFKN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.91 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|