C24H35N7O2 — CID 170155848
7-N-butyl-1-[[2-methoxy-4-[(oxan-4-ylamino)methyl]phenyl]methyl]-3-methylpyrazolo[4,5-d]pyrimidine-5,7-diamine (PubChem CID 170155848) has the molecular formula C24H35N7O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 7-N-butyl-1-[[2-methoxy-4-[(oxan-4-ylamino)methyl]phenyl]methyl]-3-methylpyrazolo[4,5-d]pyrimidine-5,7-diamine.
| Compound Name | 7-N-butyl-1-[[2-methoxy-4-[(oxan-4-ylamino)methyl]phenyl]methyl]-3-methylpyrazolo[4,5-d]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 170155848 |
| Molecular Formula | C24H35N7O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.29 |
| IUPAC Name | 7-N-butyl-1-[[2-methoxy-4-[(oxan-4-ylamino)methyl]phenyl]methyl]-3-methylpyrazolo[4,5-d]pyrimidine-5,7-diamine |
| SMILES | CCCCNc1nc(N)nc2c(C)nn(Cc3ccc(CNC4CCOCC4)cc3OC)c12 |
| InChI | InChI=1S/C24H35N7O2/c1-4-5-10-26-23-22-21(28-24(25)29-23)16(2)30-31(22)15-18-7-6-17(13-20(18)32-3)14-27-19-8-11-33-12-9-19/h6-7,13,19,27H,4-5,8-12,14-15H2,1-3H3,(H3,25,26,28,29) |
| InChIKey | QMHQCZQVARSPNT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|