C22H31N7O2 — CID 146328648
1-[[4-[(cyclobutylamino)methyl]-2-methoxyphenyl]methyl]-7-N-(2-ethoxyethyl)pyrazolo[4,5-d]pyrimidine-5,7-diamine (PubChem CID 146328648) has the molecular formula C22H31N7O2 and a molecular weight of 425.54 g/mol. Its IUPAC name is 1-[[4-[(cyclobutylamino)methyl]-2-methoxyphenyl]methyl]-7-N-(2-ethoxyethyl)pyrazolo[4,5-d]pyrimidine-5,7-diamine.
| Compound Name | 1-[[4-[(cyclobutylamino)methyl]-2-methoxyphenyl]methyl]-7-N-(2-ethoxyethyl)pyrazolo[4,5-d]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 146328648 |
| Molecular Formula | C22H31N7O2 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | 1-[[4-[(cyclobutylamino)methyl]-2-methoxyphenyl]methyl]-7-N-(2-ethoxyethyl)pyrazolo[4,5-d]pyrimidine-5,7-diamine |
| SMILES | CCOCCNc1nc(N)nc2cnn(Cc3ccc(CNC4CCC4)cc3OC)c12 |
| InChI | InChI=1S/C22H31N7O2/c1-3-31-10-9-24-21-20-18(27-22(23)28-21)13-26-29(20)14-16-8-7-15(11-19(16)30-2)12-25-17-5-4-6-17/h7-8,11,13,17,25H,3-6,9-10,12,14H2,1-2H3,(H3,23,24,27,28) |
| InChIKey | REESBUWAXFGPAF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|