C25H39N7O3 — CID 156813267
hexan-1-ol;1-[[2-methoxy-4-[[[(2R)-oxolan-2-yl]methylamino]methyl]phenyl]methyl]pyrazolo[4,5-d]pyrimidine-5,7-diamine (PubChem CID 156813267) has the molecular formula C25H39N7O3 and a molecular weight of 485.63 g/mol. Its IUPAC name is hexan-1-ol;1-[[2-methoxy-4-[[[(2R)-oxolan-2-yl]methylamino]methyl]phenyl]methyl]pyrazolo[4,5-d]pyrimidine-5,7-diamine.
| Compound Name | hexan-1-ol;1-[[2-methoxy-4-[[[(2R)-oxolan-2-yl]methylamino]methyl]phenyl]methyl]pyrazolo[4,5-d]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 156813267 |
| Molecular Formula | C25H39N7O3 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.31 |
| IUPAC Name | hexan-1-ol;1-[[2-methoxy-4-[[[(2R)-oxolan-2-yl]methylamino]methyl]phenyl]methyl]pyrazolo[4,5-d]pyrimidine-5,7-diamine |
| SMILES | CCCCCCO.COc1cc(CNC[C@H]2CCCO2)ccc1Cn1ncc2nc(N)nc(N)c21 |
| InChI | InChI=1S/C19H25N7O2.C6H14O/c1-27-16-7-12(8-22-9-14-3-2-6-28-14)4-5-13(16)11-26-17-15(10-23-26)24-19(21)25-18(17)20;1-2-3-4-5-6-7/h4-5,7,10,14,22H,2-3,6,8-9,11H2,1H3,(H4,20,21,24,25);7H,2-6H2,1H3/t14-;/m1./s1 |
| InChIKey | OABSWMFHBDWRDB-PFEQFJNWSA-N |
| XLogP | 2.88 |
| TPSA | 146.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|