C22H32N6O2 — CID 166695331
2-[4-[[5-amino-7-(butylamino)pyrazolo[4,5-d]pyrimidin-1-yl]methyl]-3-methoxyphenyl]pentan-2-ol (PubChem CID 166695331) has the molecular formula C22H32N6O2 and a molecular weight of 412.54 g/mol. Its IUPAC name is 2-[4-[[5-amino-7-(butylamino)pyrazolo[4,5-d]pyrimidin-1-yl]methyl]-3-methoxyphenyl]pentan-2-ol.
| Compound Name | 2-[4-[[5-amino-7-(butylamino)pyrazolo[4,5-d]pyrimidin-1-yl]methyl]-3-methoxyphenyl]pentan-2-ol |
|---|---|
| PubChem CID | 166695331 |
| Molecular Formula | C22H32N6O2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 2-[4-[[5-amino-7-(butylamino)pyrazolo[4,5-d]pyrimidin-1-yl]methyl]-3-methoxyphenyl]pentan-2-ol |
| SMILES | CCCCNc1nc(N)nc2cnn(Cc3ccc(C(C)(O)CCC)cc3OC)c12 |
| InChI | InChI=1S/C22H32N6O2/c1-5-7-11-24-20-19-17(26-21(23)27-20)13-25-28(19)14-15-8-9-16(12-18(15)30-4)22(3,29)10-6-2/h8-9,12-13,29H,5-7,10-11,14H2,1-4H3,(H3,23,24,26,27) |
| InChIKey | VPXGYZRQQQOQFM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|