C18H22ClFN6O — CID 165370771
7-N-butyl-1-[[4-(chloromethyl)-2-methoxyphenyl]methyl]-3-fluoropyrazolo[4,5-d]pyrimidine-5,7-diamine (PubChem CID 165370771) has the molecular formula C18H22ClFN6O and a molecular weight of 392.87 g/mol. Its IUPAC name is 7-N-butyl-1-[[4-(chloromethyl)-2-methoxyphenyl]methyl]-3-fluoropyrazolo[4,5-d]pyrimidine-5,7-diamine.
| Compound Name | 7-N-butyl-1-[[4-(chloromethyl)-2-methoxyphenyl]methyl]-3-fluoropyrazolo[4,5-d]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 165370771 |
| Molecular Formula | C18H22ClFN6O |
| Molecular Weight | 392.87 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 7-N-butyl-1-[[4-(chloromethyl)-2-methoxyphenyl]methyl]-3-fluoropyrazolo[4,5-d]pyrimidine-5,7-diamine |
| SMILES | CCCCNc1nc(N)nc2c(F)nn(Cc3ccc(CCl)cc3OC)c12 |
| InChI | InChI=1S/C18H22ClFN6O/c1-3-4-7-22-17-15-14(23-18(21)24-17)16(20)25-26(15)10-12-6-5-11(9-19)8-13(12)27-2/h5-6,8H,3-4,7,9-10H2,1-2H3,(H3,21,22,23,24) |
| InChIKey | MWXLNQUUUHETAD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.87 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|