C20H25BrClN5O — CID 171548694
7-bromo-5-[[4-(chloromethyl)-2-methoxyphenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine (PubChem CID 171548694) has the molecular formula C20H25BrClN5O and a molecular weight of 466.81 g/mol. Its IUPAC name is 7-bromo-5-[[4-(chloromethyl)-2-methoxyphenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 7-bromo-5-[[4-(chloromethyl)-2-methoxyphenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 171548694 |
| Molecular Formula | C20H25BrClN5O |
| Molecular Weight | 466.81 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 7-bromo-5-[[4-(chloromethyl)-2-methoxyphenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CCCCCNc1nc(N)nc2c(Br)cn(Cc3ccc(CCl)cc3OC)c12 |
| InChI | InChI=1S/C20H25BrClN5O/c1-3-4-5-8-24-19-18-17(25-20(23)26-19)15(21)12-27(18)11-14-7-6-13(10-22)9-16(14)28-2/h6-7,9,12H,3-5,8,10-11H2,1-2H3,(H3,23,24,25,26) |
| InChIKey | BIQPJRPEKQRGKM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.81 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|