C19H25ClN6O2 — CID 168839086
7-N-butyl-2-[[4-(chloromethyl)-2,6-dimethoxyphenyl]methyl]pyrazolo[4,3-d]pyrimidine-5,7-diamine (PubChem CID 168839086) has the molecular formula C19H25ClN6O2 and a molecular weight of 404.90 g/mol. Its IUPAC name is 7-N-butyl-2-[[4-(chloromethyl)-2,6-dimethoxyphenyl]methyl]pyrazolo[4,3-d]pyrimidine-5,7-diamine.
| Compound Name | 7-N-butyl-2-[[4-(chloromethyl)-2,6-dimethoxyphenyl]methyl]pyrazolo[4,3-d]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 168839086 |
| Molecular Formula | C19H25ClN6O2 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 7-N-butyl-2-[[4-(chloromethyl)-2,6-dimethoxyphenyl]methyl]pyrazolo[4,3-d]pyrimidine-5,7-diamine |
| SMILES | CCCCNc1nc(N)nc2cn(Cc3c(OC)cc(CCl)cc3OC)nc12 |
| InChI | InChI=1S/C19H25ClN6O2/c1-4-5-6-22-18-17-14(23-19(21)24-18)11-26(25-17)10-13-15(27-2)7-12(9-20)8-16(13)28-3/h7-8,11H,4-6,9-10H2,1-3H3,(H3,21,22,23,24) |
| InChIKey | FBCJBULQRYYQPO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|