C16H21N7O — CID 168839312
7-N-butyl-2-[(3-methoxy-4-pyridinyl)methyl]pyrazolo[4,3-d]pyrimidine-5,7-diamine (PubChem CID 168839312) has the molecular formula C16H21N7O and a molecular weight of 327.39 g/mol. Its IUPAC name is 7-N-butyl-2-[(3-methoxy-4-pyridinyl)methyl]pyrazolo[4,3-d]pyrimidine-5,7-diamine.
| Compound Name | 7-N-butyl-2-[(3-methoxy-4-pyridinyl)methyl]pyrazolo[4,3-d]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 168839312 |
| Molecular Formula | C16H21N7O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 7-N-butyl-2-[(3-methoxy-4-pyridinyl)methyl]pyrazolo[4,3-d]pyrimidine-5,7-diamine |
| SMILES | CCCCNc1nc(N)nc2cn(Cc3ccncc3OC)nc12 |
| InChI | InChI=1S/C16H21N7O/c1-3-4-6-19-15-14-12(20-16(17)21-15)10-23(22-14)9-11-5-7-18-8-13(11)24-2/h5,7-8,10H,3-4,6,9H2,1-2H3,(H3,17,19,20,21) |
| InChIKey | LUFZAQAADGBMTF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|