C26H32N8O3 — CID 168839235
1-[[1-[[4-[[5-amino-7-(butylamino)pyrazolo[4,3-d]pyrimidin-2-yl]methyl]-3-methoxyphenyl]methyl]azetidin-3-yl]methyl]pyrrole-2,5-dione (PubChem CID 168839235) has the molecular formula C26H32N8O3 and a molecular weight of 504.60 g/mol. Its IUPAC name is 1-[[1-[[4-[[5-amino-7-(butylamino)pyrazolo[4,3-d]pyrimidin-2-yl]methyl]-3-methoxyphenyl]methyl]azetidin-3-yl]methyl]pyrrole-2,5-dione.
| Compound Name | 1-[[1-[[4-[[5-amino-7-(butylamino)pyrazolo[4,3-d]pyrimidin-2-yl]methyl]-3-methoxyphenyl]methyl]azetidin-3-yl]methyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168839235 |
| Molecular Formula | C26H32N8O3 |
| Molecular Weight | 504.60 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | 1-[[1-[[4-[[5-amino-7-(butylamino)pyrazolo[4,3-d]pyrimidin-2-yl]methyl]-3-methoxyphenyl]methyl]azetidin-3-yl]methyl]pyrrole-2,5-dione |
| SMILES | CCCCNc1nc(N)nc2cn(Cc3ccc(CN4CC(CN5C(=O)C=CC5=O)C4)cc3OC)nc12 |
| InChI | InChI=1S/C26H32N8O3/c1-3-4-9-28-25-24-20(29-26(27)30-25)16-33(31-24)15-19-6-5-17(10-21(19)37-2)11-32-12-18(13-32)14-34-22(35)7-8-23(34)36/h5-8,10,16,18H,3-4,9,11-15H2,1-2H3,(H3,27,28,29,30) |
| InChIKey | SRZJSBIVOPRZGB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.60 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|