C23H36N8O2 — CID 172601409
2-[[4-[(4-aminobutylamino)methyl]-2,6-dimethoxyphenyl]methyl]-7-N-butylpyrazolo[4,3-d]pyrimidine-5,7-diamine (PubChem CID 172601409) has the molecular formula C23H36N8O2 and a molecular weight of 456.60 g/mol. Its IUPAC name is 2-[[4-[(4-aminobutylamino)methyl]-2,6-dimethoxyphenyl]methyl]-7-N-butylpyrazolo[4,3-d]pyrimidine-5,7-diamine.
| Compound Name | 2-[[4-[(4-aminobutylamino)methyl]-2,6-dimethoxyphenyl]methyl]-7-N-butylpyrazolo[4,3-d]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 172601409 |
| Molecular Formula | C23H36N8O2 |
| Molecular Weight | 456.60 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | 2-[[4-[(4-aminobutylamino)methyl]-2,6-dimethoxyphenyl]methyl]-7-N-butylpyrazolo[4,3-d]pyrimidine-5,7-diamine |
| SMILES | CCCCNc1nc(N)nc2cn(Cc3c(OC)cc(CNCCCCN)cc3OC)nc12 |
| InChI | InChI=1S/C23H36N8O2/c1-4-5-10-27-22-21-18(28-23(25)29-22)15-31(30-21)14-17-19(32-2)11-16(12-20(17)33-3)13-26-9-7-6-8-24/h11-12,15,26H,4-10,13-14,24H2,1-3H3,(H3,25,27,28,29) |
| InChIKey | OEFHUCVPNLEARL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 138.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.60 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|