C19H29N9O — CID 168839114
2-[[6-(3-aminopropylamino)-3-methoxy-2-pyridinyl]methyl]-7-N-butylpyrazolo[4,3-d]pyrimidine-5,7-diamine (PubChem CID 168839114) has the molecular formula C19H29N9O and a molecular weight of 399.50 g/mol. Its IUPAC name is 2-[[6-(3-aminopropylamino)-3-methoxy-2-pyridinyl]methyl]-7-N-butylpyrazolo[4,3-d]pyrimidine-5,7-diamine.
| Compound Name | 2-[[6-(3-aminopropylamino)-3-methoxy-2-pyridinyl]methyl]-7-N-butylpyrazolo[4,3-d]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 168839114 |
| Molecular Formula | C19H29N9O |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | 2-[[6-(3-aminopropylamino)-3-methoxy-2-pyridinyl]methyl]-7-N-butylpyrazolo[4,3-d]pyrimidine-5,7-diamine |
| SMILES | CCCCNc1nc(N)nc2cn(Cc3nc(NCCCN)ccc3OC)nc12 |
| InChI | InChI=1S/C19H29N9O/c1-3-4-9-23-18-17-14(25-19(21)26-18)12-28(27-17)11-13-15(29-2)6-7-16(24-13)22-10-5-8-20/h6-7,12H,3-5,8-11,20H2,1-2H3,(H,22,24)(H3,21,23,25,26) |
| InChIKey | WZQBQBDYPUFQQT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 141.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|