C22H32N6O3S — CID 153163988
7-N-butyl-2-[[2-methoxy-4-(4-methylsulfonylbutyl)phenyl]methyl]pyrazolo[4,3-d]pyrimidine-5,7-diamine (PubChem CID 153163988) has the molecular formula C22H32N6O3S and a molecular weight of 460.60 g/mol. Its IUPAC name is 7-N-butyl-2-[[2-methoxy-4-(4-methylsulfonylbutyl)phenyl]methyl]pyrazolo[4,3-d]pyrimidine-5,7-diamine.
| Compound Name | 7-N-butyl-2-[[2-methoxy-4-(4-methylsulfonylbutyl)phenyl]methyl]pyrazolo[4,3-d]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 153163988 |
| Molecular Formula | C22H32N6O3S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 7-N-butyl-2-[[2-methoxy-4-(4-methylsulfonylbutyl)phenyl]methyl]pyrazolo[4,3-d]pyrimidine-5,7-diamine |
| SMILES | CCCCNc1nc(N)nc2cn(Cc3ccc(CCCCS(C)(=O)=O)cc3OC)nc12 |
| InChI | InChI=1S/C22H32N6O3S/c1-4-5-11-24-21-20-18(25-22(23)26-21)15-28(27-20)14-17-10-9-16(13-19(17)31-2)8-6-7-12-32(3,29)30/h9-10,13,15H,4-8,11-12,14H2,1-3H3,(H3,23,24,25,26) |
| InChIKey | WCWWIMKZAREHAQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 125.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|