C24H37N7O2 — CID 177265278
2-[[5-amino-2-[[4-(butylaminomethyl)-2-methoxyphenyl]methyl]pyrazolo[4,3-d]pyrimidin-7-yl]-butylamino]ethanol (PubChem CID 177265278) has the molecular formula C24H37N7O2 and a molecular weight of 455.61 g/mol. Its IUPAC name is 2-[[5-amino-2-[[4-(butylaminomethyl)-2-methoxyphenyl]methyl]pyrazolo[4,3-d]pyrimidin-7-yl]-butylamino]ethanol.
| Compound Name | 2-[[5-amino-2-[[4-(butylaminomethyl)-2-methoxyphenyl]methyl]pyrazolo[4,3-d]pyrimidin-7-yl]-butylamino]ethanol |
|---|---|
| PubChem CID | 177265278 |
| Molecular Formula | C24H37N7O2 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.30 |
| IUPAC Name | 2-[[5-amino-2-[[4-(butylaminomethyl)-2-methoxyphenyl]methyl]pyrazolo[4,3-d]pyrimidin-7-yl]-butylamino]ethanol |
| SMILES | CCCCNCc1ccc(Cn2cc3nc(N)nc(N(CCO)CCCC)c3n2)c(OC)c1 |
| InChI | InChI=1S/C24H37N7O2/c1-4-6-10-26-15-18-8-9-19(21(14-18)33-3)16-31-17-20-22(29-31)23(28-24(25)27-20)30(12-13-32)11-7-5-2/h8-9,14,17,26,32H,4-7,10-13,15-16H2,1-3H3,(H2,25,27) |
| InChIKey | AQWISOCVPBLBAB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|