C28H38N6O2 — CID 177317412
4-N-butyl-5-[[5-[(cyclopropylamino)methyl]-2-methoxyphenyl]methyl]pyrimido[5,4-b]indole-2,4-diamine;ethanol (PubChem CID 177317412) has the molecular formula C28H38N6O2 and a molecular weight of 490.65 g/mol. Its IUPAC name is 4-N-butyl-5-[[5-[(cyclopropylamino)methyl]-2-methoxyphenyl]methyl]pyrimido[5,4-b]indole-2,4-diamine;ethanol.
| Compound Name | 4-N-butyl-5-[[5-[(cyclopropylamino)methyl]-2-methoxyphenyl]methyl]pyrimido[5,4-b]indole-2,4-diamine;ethanol |
|---|---|
| PubChem CID | 177317412 |
| Molecular Formula | C28H38N6O2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | 4-N-butyl-5-[[5-[(cyclopropylamino)methyl]-2-methoxyphenyl]methyl]pyrimido[5,4-b]indole-2,4-diamine;ethanol |
| SMILES | CCCCNc1nc(N)nc2c3ccccc3n(Cc3cc(CNC4CC4)ccc3OC)c12.CCO |
| InChI | InChI=1S/C26H32N6O.C2H6O/c1-3-4-13-28-25-24-23(30-26(27)31-25)20-7-5-6-8-21(20)32(24)16-18-14-17(9-12-22(18)33-2)15-29-19-10-11-19;1-2-3/h5-9,12,14,19,29H,3-4,10-11,13,15-16H2,1-2H3,(H3,27,28,30,31);3H,2H2,1H3 |
| InChIKey | IJVZGOQWEZNPPY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|