C27H37N7O3 — CID 177317641
2-[[3-[[2-amino-4-(butylamino)pyrimido[5,4-b]indol-5-yl]methyl]-4-methoxyphenyl]methylamino]acetamide;ethanol (PubChem CID 177317641) has the molecular formula C27H37N7O3 and a molecular weight of 507.64 g/mol. Its IUPAC name is 2-[[3-[[2-amino-4-(butylamino)pyrimido[5,4-b]indol-5-yl]methyl]-4-methoxyphenyl]methylamino]acetamide;ethanol.
| Compound Name | 2-[[3-[[2-amino-4-(butylamino)pyrimido[5,4-b]indol-5-yl]methyl]-4-methoxyphenyl]methylamino]acetamide;ethanol |
|---|---|
| PubChem CID | 177317641 |
| Molecular Formula | C27H37N7O3 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.30 |
| IUPAC Name | 2-[[3-[[2-amino-4-(butylamino)pyrimido[5,4-b]indol-5-yl]methyl]-4-methoxyphenyl]methylamino]acetamide;ethanol |
| SMILES | CCCCNc1nc(N)nc2c3ccccc3n(Cc3cc(CNCC(N)=O)ccc3OC)c12.CCO |
| InChI | InChI=1S/C25H31N7O2.C2H6O/c1-3-4-11-29-24-23-22(30-25(27)31-24)18-7-5-6-8-19(18)32(23)15-17-12-16(9-10-20(17)34-2)13-28-14-21(26)33;1-2-3/h5-10,12,28H,3-4,11,13-15H2,1-2H3,(H2,26,33)(H3,27,29,30,31);3H,2H2,1H3 |
| InChIKey | GDYDNKDEDVTLQM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 153.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|