C26H31N7O — CID 177317725
4-N-butyl-5-[[2-methoxy-5-(1,2,3,6-tetrahydropyridin-4-yl)-3-pyridinyl]methyl]pyrimido[5,4-b]indole-2,4-diamine (PubChem CID 177317725) has the molecular formula C26H31N7O and a molecular weight of 457.58 g/mol. Its IUPAC name is 4-N-butyl-5-[[2-methoxy-5-(1,2,3,6-tetrahydropyridin-4-yl)-3-pyridinyl]methyl]pyrimido[5,4-b]indole-2,4-diamine.
| Compound Name | 4-N-butyl-5-[[2-methoxy-5-(1,2,3,6-tetrahydropyridin-4-yl)-3-pyridinyl]methyl]pyrimido[5,4-b]indole-2,4-diamine |
|---|---|
| PubChem CID | 177317725 |
| Molecular Formula | C26H31N7O |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | 4-N-butyl-5-[[2-methoxy-5-(1,2,3,6-tetrahydropyridin-4-yl)-3-pyridinyl]methyl]pyrimido[5,4-b]indole-2,4-diamine |
| SMILES | CCCCNc1nc(N)nc2c3ccccc3n(Cc3cc(C4=CCNCC4)cnc3OC)c12 |
| InChI | InChI=1S/C26H31N7O/c1-3-4-11-29-24-23-22(31-26(27)32-24)20-7-5-6-8-21(20)33(23)16-19-14-18(15-30-25(19)34-2)17-9-12-28-13-10-17/h5-9,14-15,28H,3-4,10-13,16H2,1-2H3,(H3,27,29,31,32) |
| InChIKey | UAEVONNXBBVFCJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|